C21H24F3N7O2 — CID 140821903
[2-(tert-butylamino)-8-[3-(trifluoromethyl)anilino]purin-9-yl] pyrrolidine-1-carboxylate (PubChem CID 140821903) has the molecular formula C21H24F3N7O2 and a molecular weight of 463.46 g/mol. Its IUPAC name is [2-(tert-butylamino)-8-[3-(trifluoromethyl)anilino]purin-9-yl] pyrrolidine-1-carboxylate.
| Compound Name | [2-(tert-butylamino)-8-[3-(trifluoromethyl)anilino]purin-9-yl] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 140821903 |
| Molecular Formula | C21H24F3N7O2 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | [2-(tert-butylamino)-8-[3-(trifluoromethyl)anilino]purin-9-yl] pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)Nc1ncc2nc(Nc3cccc(C(F)(F)F)c3)n(OC(=O)N3CCCC3)c2n1 |
| InChI | InChI=1S/C21H24F3N7O2/c1-20(2,3)29-17-25-12-15-16(28-17)31(33-19(32)30-9-4-5-10-30)18(27-15)26-14-8-6-7-13(11-14)21(22,23)24/h6-8,11-12H,4-5,9-10H2,1-3H3,(H,26,27)(H,25,28,29) |
| InChIKey | OCYMIEWCOKOQLT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |