C17H19F3N6 — CID 150221688
9-pentyl-8-N-[3-(trifluoromethyl)phenyl]purine-2,8-diamine (PubChem CID 150221688) has the molecular formula C17H19F3N6 and a molecular weight of 364.38 g/mol. Its IUPAC name is 9-pentyl-8-N-[3-(trifluoromethyl)phenyl]purine-2,8-diamine.
| Compound Name | 9-pentyl-8-N-[3-(trifluoromethyl)phenyl]purine-2,8-diamine |
|---|---|
| PubChem CID | 150221688 |
| Molecular Formula | C17H19F3N6 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 9-pentyl-8-N-[3-(trifluoromethyl)phenyl]purine-2,8-diamine |
| SMILES | CCCCCn1c(Nc2cccc(C(F)(F)F)c2)nc2cnc(N)nc21 |
| InChI | InChI=1S/C17H19F3N6/c1-2-3-4-8-26-14-13(10-22-15(21)25-14)24-16(26)23-12-7-5-6-11(9-12)17(18,19)20/h5-7,9-10H,2-4,8H2,1H3,(H,23,24)(H2,21,22,25) |
| InChIKey | FTPUTFCSZPSOLA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|