C10H16N6 — CID 140922061
9-pentylpurine-2,8-diamine (PubChem CID 140922061) has the molecular formula C10H16N6 and a molecular weight of 220.28 g/mol. Its IUPAC name is 9-pentylpurine-2,8-diamine.
| Compound Name | 9-pentylpurine-2,8-diamine |
|---|---|
| PubChem CID | 140922061 |
| Molecular Formula | C10H16N6 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 9-pentylpurine-2,8-diamine |
| SMILES | CCCCCn1c(N)nc2cnc(N)nc21 |
| InChI | InChI=1S/C10H16N6/c1-2-3-4-5-16-8-7(14-10(16)12)6-13-9(11)15-8/h6H,2-5H2,1H3,(H2,12,14)(H2,11,13,15) |
| InChIKey | BFNJTROVXZWJCU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|