C17H13ClF3N3 — CID 156518197
4-(3-chlorophenyl)-1-methyl-N-[3-(trifluoromethyl)phenyl]imidazol-2-amine (PubChem CID 156518197) has the molecular formula C17H13ClF3N3 and a molecular weight of 351.76 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-1-methyl-N-[3-(trifluoromethyl)phenyl]imidazol-2-amine.
| Compound Name | 4-(3-chlorophenyl)-1-methyl-N-[3-(trifluoromethyl)phenyl]imidazol-2-amine |
|---|---|
| PubChem CID | 156518197 |
| Molecular Formula | C17H13ClF3N3 |
| Molecular Weight | 351.76 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 4-(3-chlorophenyl)-1-methyl-N-[3-(trifluoromethyl)phenyl]imidazol-2-amine |
| SMILES | Cn1cc(-c2cccc(Cl)c2)nc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13ClF3N3/c1-24-10-15(11-4-2-6-13(18)8-11)23-16(24)22-14-7-3-5-12(9-14)17(19,20)21/h2-10H,1H3,(H,22,23) |
| InChIKey | QDVKWCKVQXHWOU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.76 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |