C45H23N5O — CID 140822839
7-[3-[3-(3-cyanocarbazol-9-yl)phenyl]phenyl]-4-isocyano-[1]benzofuro[2,3-b]carbazole-6-carbonitrile (PubChem CID 140822839) has the molecular formula C45H23N5O and a molecular weight of 649.71 g/mol. Its IUPAC name is 7-[3-[3-(3-cyanocarbazol-9-yl)phenyl]phenyl]-4-isocyano-[1]benzofuro[2,3-b]carbazole-6-carbonitrile.
| Compound Name | 7-[3-[3-(3-cyanocarbazol-9-yl)phenyl]phenyl]-4-isocyano-[1]benzofuro[2,3-b]carbazole-6-carbonitrile |
|---|---|
| PubChem CID | 140822839 |
| Molecular Formula | C45H23N5O |
| Molecular Weight | 649.71 g/mol |
| Exact Mass | 649.19 |
| IUPAC Name | 7-[3-[3-(3-cyanocarbazol-9-yl)phenyl]phenyl]-4-isocyano-[1]benzofuro[2,3-b]carbazole-6-carbonitrile |
| SMILES | [C-]#[N+]c1cccc2c1oc1c(C#N)c3c(cc12)c1ccccc1n3-c1cccc(-c2cccc(-n3c4ccccc4c4cc(C#N)ccc43)c2)c1 |
| InChI | InChI=1S/C45H23N5O/c1-48-39-16-8-15-34-37-24-36-33-14-3-5-18-41(33)50(43(36)38(26-47)44(37)51-45(34)39)31-12-7-10-29(23-31)28-9-6-11-30(22-28)49-40-17-4-2-13-32(40)35-21-27(25-46)19-20-42(35)49/h2-24H |
| InChIKey | QSKWTDCODNELJI-UHFFFAOYSA-N |
| XLogP | 11.74 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.71 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|