C43H23N3SSe — CID 140822887
7-[8-(3-isocyanocarbazol-9-yl)dibenzoselenophen-2-yl]-[1]benzothiolo[2,3-b]carbazole (PubChem CID 140822887) has the molecular formula C43H23N3SSe and a molecular weight of 692.71 g/mol. Its IUPAC name is 7-[8-(3-isocyanocarbazol-9-yl)dibenzoselenophen-2-yl]-[1]benzothiolo[2,3-b]carbazole.
| Compound Name | 7-[8-(3-isocyanocarbazol-9-yl)dibenzoselenophen-2-yl]-[1]benzothiolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 140822887 |
| Molecular Formula | C43H23N3SSe |
| Molecular Weight | 692.71 g/mol |
| Exact Mass | 693.08 |
| IUPAC Name | 7-[8-(3-isocyanocarbazol-9-yl)dibenzoselenophen-2-yl]-[1]benzothiolo[2,3-b]carbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1ccccc1n2-c1ccc2[se]c3ccc(-n4c5ccccc5c5cc6c(cc54)sc4ccccc46)cc3c2c1 |
| InChI | InChI=1S/C43H23N3SSe/c1-44-25-14-17-38-31(20-25)28-8-2-5-11-36(28)45(38)26-15-18-42-34(21-26)35-22-27(16-19-43(35)48-42)46-37-12-6-3-9-29(37)32-23-33-30-10-4-7-13-40(30)47-41(33)24-39(32)46/h2-24H |
| InChIKey | YYJOHHVYFZTOQO-UHFFFAOYSA-N |
| XLogP | 12.16 |
| TPSA | 14.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.71 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|