C44H22N4OSe — CID 140822877
7-[8-(3,6-diisocyanocarbazol-9-yl)dibenzoselenophen-2-yl]-[1]benzofuro[2,3-b]carbazole (PubChem CID 140822877) has the molecular formula C44H22N4OSe and a molecular weight of 701.65 g/mol. Its IUPAC name is 7-[8-(3,6-diisocyanocarbazol-9-yl)dibenzoselenophen-2-yl]-[1]benzofuro[2,3-b]carbazole.
| Compound Name | 7-[8-(3,6-diisocyanocarbazol-9-yl)dibenzoselenophen-2-yl]-[1]benzofuro[2,3-b]carbazole |
|---|---|
| PubChem CID | 140822877 |
| Molecular Formula | C44H22N4OSe |
| Molecular Weight | 701.65 g/mol |
| Exact Mass | 702.10 |
| IUPAC Name | 7-[8-(3,6-diisocyanocarbazol-9-yl)dibenzoselenophen-2-yl]-[1]benzofuro[2,3-b]carbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc([N+]#[C-])ccc1n2-c1ccc2[se]c3ccc(-n4c5ccccc5c5cc6c(cc54)oc4ccccc46)cc3c2c1 |
| InChI | InChI=1S/C44H22N4OSe/c1-45-25-11-15-38-31(19-25)32-20-26(46-2)12-16-39(32)47(38)27-13-17-43-35(21-27)36-22-28(14-18-44(36)50-43)48-37-9-5-3-7-29(37)33-23-34-30-8-4-6-10-41(30)49-42(34)24-40(33)48/h3-24H |
| InChIKey | RMZOKKDIJMNWDR-UHFFFAOYSA-N |
| XLogP | 12.25 |
| TPSA | 31.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.65 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|