C18H14FN5O2 — CID 140823868
ethyl 1-[6-(4-fluoroanilino)-4-isocyano-2-pyridinyl]pyrazole-3-carboxylate (PubChem CID 140823868) has the molecular formula C18H14FN5O2 and a molecular weight of 351.34 g/mol. Its IUPAC name is ethyl 1-[6-(4-fluoroanilino)-4-isocyano-2-pyridinyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 1-[6-(4-fluoroanilino)-4-isocyano-2-pyridinyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 140823868 |
| Molecular Formula | C18H14FN5O2 |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | ethyl 1-[6-(4-fluoroanilino)-4-isocyano-2-pyridinyl]pyrazole-3-carboxylate |
| SMILES | [C-]#[N+]c1cc(Nc2ccc(F)cc2)nc(-n2ccc(C(=O)OCC)n2)c1 |
| InChI | InChI=1S/C18H14FN5O2/c1-3-26-18(25)15-8-9-24(23-15)17-11-14(20-2)10-16(22-17)21-13-6-4-12(19)5-7-13/h4-11H,3H2,1H3,(H,21,22) |
| InChIKey | FTODBANLRLYGKY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|