C31H38BNO4 — CID 140826477
3-(2-phenylethoxy)-2-(1,1,3,3-tetramethyl-2-benzofuran-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 140826477) has the molecular formula C31H38BNO4 and a molecular weight of 499.46 g/mol. Its IUPAC name is 3-(2-phenylethoxy)-2-(1,1,3,3-tetramethyl-2-benzofuran-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 3-(2-phenylethoxy)-2-(1,1,3,3-tetramethyl-2-benzofuran-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 140826477 |
| Molecular Formula | C31H38BNO4 |
| Molecular Weight | 499.46 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | 3-(2-phenylethoxy)-2-(1,1,3,3-tetramethyl-2-benzofuran-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC1(C)OC(C)(C)c2cc(-c3ncc(B4OC(C)(C)C(C)(C)O4)cc3OCCc3ccccc3)ccc21 |
| InChI | InChI=1S/C31H38BNO4/c1-28(2)24-15-14-22(18-25(24)29(3,4)35-28)27-26(34-17-16-21-12-10-9-11-13-21)19-23(20-33-27)32-36-30(5,6)31(7,8)37-32/h9-15,18-20H,16-17H2,1-8H3 |
| InChIKey | YISVYIWRANAQEW-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.46 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|