C27H35BN2O2 — CID 140826659
2-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-isocyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 140826659) has the molecular formula C27H35BN2O2 and a molecular weight of 430.40 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-isocyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-isocyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 140826659 |
| Molecular Formula | C27H35BN2O2 |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | 2-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-isocyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | [C-]#[N+]c1cc(B2OC(C)(C)C(C)(C)O2)cnc1-c1ccc2c(c1)C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C27H35BN2O2/c1-23(2)19-13-12-17(14-20(19)24(3,4)25(23,5)6)22-21(29-11)15-18(16-30-22)28-31-26(7,8)27(9,10)32-28/h12-16H,1-10H3 |
| InChIKey | HBLYHZISHADMRT-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 35.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|