C23H19N2O+ — CID 140827648
1-methyl-6-(3-methylnaphtho[2,3-b][1]benzofuran-4-yl)-3-(trideuteriomethyl)pyridazin-1-ium (PubChem CID 140827648) has the molecular formula C23H19N2O+ and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-methyl-6-(3-methylnaphtho[2,3-b][1]benzofuran-4-yl)-3-(trideuteriomethyl)pyridazin-1-ium.
| Compound Name | 1-methyl-6-(3-methylnaphtho[2,3-b][1]benzofuran-4-yl)-3-(trideuteriomethyl)pyridazin-1-ium |
|---|---|
| PubChem CID | 140827648 |
| Molecular Formula | C23H19N2O+ |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-methyl-6-(3-methylnaphtho[2,3-b][1]benzofuran-4-yl)-3-(trideuteriomethyl)pyridazin-1-ium |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2c(C)ccc3c2oc2cc4ccccc4cc23)[n+](C)n1 |
| InChI | InChI=1S/C23H19N2O/c1-14-8-10-18-19-12-16-6-4-5-7-17(16)13-21(19)26-23(18)22(14)20-11-9-15(2)24-25(20)3/h4-13H,1-3H3/q+1/i2D3 |
| InChIKey | DFPVNHKQRCUGTI-BMSJAHLVSA-N |
| XLogP | 5.24 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|