C25H21N6O+ — CID 140828158
2-amino-N-[(1R)-1-(7-ethynyl-1-phenyl-3H-indol-1-ium-2-yl)ethyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 140828158) has the molecular formula C25H21N6O+ and a molecular weight of 421.48 g/mol. Its IUPAC name is 2-amino-N-[(1R)-1-(7-ethynyl-1-phenyl-3H-indol-1-ium-2-yl)ethyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 2-amino-N-[(1R)-1-(7-ethynyl-1-phenyl-3H-indol-1-ium-2-yl)ethyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 140828158 |
| Molecular Formula | C25H21N6O+ |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-amino-N-[(1R)-1-(7-ethynyl-1-phenyl-3H-indol-1-ium-2-yl)ethyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | C#Cc1cccc2c1[N+](c1ccccc1)=C([C@@H](C)NC(=O)c1c(N)nn3cccnc13)C2 |
| InChI | InChI=1S/C25H20N6O/c1-3-17-9-7-10-18-15-20(31(22(17)18)19-11-5-4-6-12-19)16(2)28-25(32)21-23(26)29-30-14-8-13-27-24(21)30/h1,4-14,16H,15H2,2H3,(H2-,26,28,29,32)/p+1/t16-/m1/s1 |
| InChIKey | AWGJRHXZQCMQGN-MRXNPFEDSA-O |
| XLogP | 2.94 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|