C17H25OS2+ — CID 140828199
1-[4-(1-methylcyclohexyl)oxyphenyl]-1,4-dithian-1-ium (PubChem CID 140828199) has the molecular formula C17H25OS2+ and a molecular weight of 309.52 g/mol. Its IUPAC name is 1-[4-(1-methylcyclohexyl)oxyphenyl]-1,4-dithian-1-ium.
| Compound Name | 1-[4-(1-methylcyclohexyl)oxyphenyl]-1,4-dithian-1-ium |
|---|---|
| PubChem CID | 140828199 |
| Molecular Formula | C17H25OS2+ |
| Molecular Weight | 309.52 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 1-[4-(1-methylcyclohexyl)oxyphenyl]-1,4-dithian-1-ium |
| SMILES | CC1(Oc2ccc([S+]3CCSCC3)cc2)CCCCC1 |
| InChI | InChI=1S/C17H25OS2/c1-17(9-3-2-4-10-17)18-15-5-7-16(8-6-15)20-13-11-19-12-14-20/h5-8H,2-4,9-14H2,1H3/q+1 |
| InChIKey | MFTGBTYNVKEDKQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|