C14H18I2O — CID 146783563
1-(1,2-diiodoethyl)-4-(1-methylcyclopentyl)oxybenzene (PubChem CID 146783563) has the molecular formula C14H18I2O and a molecular weight of 456.11 g/mol. Its IUPAC name is 1-(1,2-diiodoethyl)-4-(1-methylcyclopentyl)oxybenzene.
| Compound Name | 1-(1,2-diiodoethyl)-4-(1-methylcyclopentyl)oxybenzene |
|---|---|
| PubChem CID | 146783563 |
| Molecular Formula | C14H18I2O |
| Molecular Weight | 456.11 g/mol |
| Exact Mass | 455.94 |
| IUPAC Name | 1-(1,2-diiodoethyl)-4-(1-methylcyclopentyl)oxybenzene |
| SMILES | CC1(Oc2ccc(C(I)CI)cc2)CCCC1 |
| InChI | InChI=1S/C14H18I2O/c1-14(8-2-3-9-14)17-12-6-4-11(5-7-12)13(16)10-15/h4-7,13H,2-3,8-10H2,1H3 |
| InChIKey | RUDJQPOKKGUMLF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.11 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|