C28H22N8S2Zn — CID 140829847
zinc bis((E)-N-[(E)-1-pyridin-2-ylethylideneamino]-1,3-benzothiazol-3-id-2-imine) (PubChem CID 140829847) has the molecular formula C28H22N8S2Zn and a molecular weight of 600.06 g/mol. Its IUPAC name is zinc bis((E)-N-[(E)-1-pyridin-2-ylethylideneamino]-1,3-benzothiazol-3-id-2-imine).
| Compound Name | zinc bis((E)-N-[(E)-1-pyridin-2-ylethylideneamino]-1,3-benzothiazol-3-id-2-imine) |
|---|---|
| PubChem CID | 140829847 |
| Molecular Formula | C28H22N8S2Zn |
| Molecular Weight | 600.06 g/mol |
| Exact Mass | 598.07 |
| IUPAC Name | zinc bis((E)-N-[(E)-1-pyridin-2-ylethylideneamino]-1,3-benzothiazol-3-id-2-imine) |
| SMILES | C/C(=N/N=c1\[n-]c2ccccc2s1)c1ccccn1.C/C(=N\N=c1/[n-]c2ccccc2s1)c1ccccn1.[Zn+2] |
| InChI | InChI=1S/2C14H11N4S.Zn/c2*1-10(11-6-4-5-9-15-11)17-18-14-16-12-7-2-3-8-13(12)19-14;/h2*2-9H,1H3;/q2*-1;+2/b17-10+;17-10-; |
| InChIKey | LDFOMUXXPRRILC-XELOZCAVSA-N |
| XLogP | 5.15 |
| TPSA | 103.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.06 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|