C24H36N2O2 — CID 140837543
(3R)-3-[3-[4-(2-propan-2-ylphenyl)piperazin-1-yl]propyl]-2-oxaspiro[4.4]nonan-1-one (PubChem CID 140837543) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is (3R)-3-[3-[4-(2-propan-2-ylphenyl)piperazin-1-yl]propyl]-2-oxaspiro[4.4]nonan-1-one.
| Compound Name | (3R)-3-[3-[4-(2-propan-2-ylphenyl)piperazin-1-yl]propyl]-2-oxaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 140837543 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | (3R)-3-[3-[4-(2-propan-2-ylphenyl)piperazin-1-yl]propyl]-2-oxaspiro[4.4]nonan-1-one |
| SMILES | CC(C)c1ccccc1N1CCN(CCC[C@@H]2CC3(CCCC3)C(=O)O2)CC1 |
| InChI | InChI=1S/C24H36N2O2/c1-19(2)21-9-3-4-10-22(21)26-16-14-25(15-17-26)13-7-8-20-18-24(23(27)28-20)11-5-6-12-24/h3-4,9-10,19-20H,5-8,11-18H2,1-2H3/t20-/m1/s1 |
| InChIKey | RGSOVLUJSNLSRU-HXUWFJFHSA-N |
| XLogP | 4.59 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |