C26H41N3O4 — CID 158821772
8-ethyl-3-[2-[4-(2-propan-2-ylphenyl)piperazin-1-yl]ethyl]-2-oxa-8-azaspiro[4.5]decan-1-one;formic acid (PubChem CID 158821772) has the molecular formula C26H41N3O4 and a molecular weight of 459.63 g/mol. Its IUPAC name is 8-ethyl-3-[2-[4-(2-propan-2-ylphenyl)piperazin-1-yl]ethyl]-2-oxa-8-azaspiro[4.5]decan-1-one;formic acid.
| Compound Name | 8-ethyl-3-[2-[4-(2-propan-2-ylphenyl)piperazin-1-yl]ethyl]-2-oxa-8-azaspiro[4.5]decan-1-one;formic acid |
|---|---|
| PubChem CID | 158821772 |
| Molecular Formula | C26H41N3O4 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.31 |
| IUPAC Name | 8-ethyl-3-[2-[4-(2-propan-2-ylphenyl)piperazin-1-yl]ethyl]-2-oxa-8-azaspiro[4.5]decan-1-one;formic acid |
| SMILES | CCN1CCC2(CC1)CC(CCN1CCN(c3ccccc3C(C)C)CC1)OC2=O.O=CO |
| InChI | InChI=1S/C25H39N3O2.CH2O2/c1-4-26-13-10-25(11-14-26)19-21(30-24(25)29)9-12-27-15-17-28(18-16-27)23-8-6-5-7-22(23)20(2)3;2-1-3/h5-8,20-21H,4,9-19H2,1-3H3;1H,(H,2,3) |
| InChIKey | IVYQOGJPIRLFBY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|