C19H21NO5 — CID 140839328
[5-(hydroxymethyl)-6-methoxynaphthalene-2-carbonyl] piperidine-1-carboxylate (PubChem CID 140839328) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is [5-(hydroxymethyl)-6-methoxynaphthalene-2-carbonyl] piperidine-1-carboxylate.
| Compound Name | [5-(hydroxymethyl)-6-methoxynaphthalene-2-carbonyl] piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140839328 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | [5-(hydroxymethyl)-6-methoxynaphthalene-2-carbonyl] piperidine-1-carboxylate |
| SMILES | COc1ccc2cc(C(=O)OC(=O)N3CCCCC3)ccc2c1CO |
| InChI | InChI=1S/C19H21NO5/c1-24-17-8-6-13-11-14(5-7-15(13)16(17)12-21)18(22)25-19(23)20-9-3-2-4-10-20/h5-8,11,21H,2-4,9-10,12H2,1H3 |
| InChIKey | VXHUBDSVBVTSBG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|