About bis(2-methylbutan-2-ylimino)molybdenum(2+);ethyl(propyl)azanide
bis(2-methylbutan-2-ylimino)molybdenum(2+);ethyl(propyl)azanide (PubChem CID 140839947) has the molecular formula C20H46MoN4
and a molecular weight of 438.56 g/mol. Its IUPAC name is bis(2-methylbutan-2-ylimino)molybdenum(2+);ethyl(propyl)azanide.
Molecular Properties
| Compound Name | bis(2-methylbutan-2-ylimino)molybdenum(2+);ethyl(propyl)azanide |
| PubChem CID | 140839947 |
| Molecular Formula | C20H46MoN4 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | bis(2-methylbutan-2-ylimino)molybdenum(2+);ethyl(propyl)azanide |
| SMILES | CCC(C)(C)N=[Mo+2]=NC(C)(C)CC.CCC[N-]CC.CCC[N-]CC |
| InChI | InChI=1S/2C5H11N.2C5H12N.Mo/c2*1-4-5(2,3)6;2*1-3-5-6-4-2;/h2*4H2,1-3H3;2*3-5H2,1-2H3;/q;;2*-1;+2 |
| InChIKey | HTTHBSKLUVGCFH-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylbutan-2-ylimino)molybdenum(2+);ethyl(propyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylbutan-2-ylimino)molybdenum(2+);ethyl(propyl)azanide?
The IUPAC name of bis(2-methylbutan-2-ylimino)molybdenum(2+);ethyl(propyl)azanide (CID 140839947) is bis(2-methylbutan-2-ylimino)molybdenum(2+);ethyl(propyl)azanide.
What is the SMILES notation for bis(2-methylbutan-2-ylimino)molybdenum(2+);ethyl(propyl)azanide?
The canonical SMILES for bis(2-methylbutan-2-ylimino)molybdenum(2+);ethyl(propyl)azanide is CCC(C)(C)N=[Mo+2]=NC(C)(C)CC.CCC[N-]CC.CCC[N-]CC.
What is the InChIKey of bis(2-methylbutan-2-ylimino)molybdenum(2+);ethyl(propyl)azanide?
The InChIKey is HTTHBSKLUVGCFH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H11N.2C5H12N.Mo/c2*1-4-5(2,3)6;2*1-3-5-6-4-2;/h2*4H2,1-3H3;2*3-5H2,1-2H3;/q;;2*-1;+2.
What are the key properties of bis(2-methylbutan-2-ylimino)molybdenum(2+);ethyl(propyl)azanide?
bis(2-methylbutan-2-ylimino)molybdenum(2+);ethyl(propyl)azanide has a molecular weight of 438.56 g/mol, XLogP of 7.39, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylbutan-2-ylimino)molybdenum(2+);ethyl(propyl)azanide is sourced from PubChem (CID 140839947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).