About tert-butyl N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)-2-phenylethyl]carbamate
tert-butyl N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)-2-phenylethyl]carbamate (PubChem CID 140840685) has the molecular formula C22H27N3O2
and a molecular weight of 365.48 g/mol. Its IUPAC name is tert-butyl N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)-2-phenylethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)-2-phenylethyl]carbamate |
| PubChem CID | 140840685 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | tert-butyl N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)-2-phenylethyl]carbamate |
| SMILES | Cc1cc2nc(C(CNC(=O)OC(C)(C)C)c3ccccc3)[nH]c2cc1C |
| InChI | InChI=1S/C22H27N3O2/c1-14-11-18-19(12-15(14)2)25-20(24-18)17(16-9-7-6-8-10-16)13-23-21(26)27-22(3,4)5/h6-12,17H,13H2,1-5H3,(H,23,26)(H,24,25) |
| InChIKey | GEDQASPJLZKBOS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)-2-phenylethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)-2-phenylethyl]carbamate?
The IUPAC name of tert-butyl N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)-2-phenylethyl]carbamate (CID 140840685) is tert-butyl N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)-2-phenylethyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)-2-phenylethyl]carbamate?
The canonical SMILES for tert-butyl N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)-2-phenylethyl]carbamate is Cc1cc2nc(C(CNC(=O)OC(C)(C)C)c3ccccc3)[nH]c2cc1C.
What is the InChIKey of tert-butyl N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)-2-phenylethyl]carbamate?
The InChIKey is GEDQASPJLZKBOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N3O2/c1-14-11-18-19(12-15(14)2)25-20(24-18)17(16-9-7-6-8-10-16)13-23-21(26)27-22(3,4)5/h6-12,17H,13H2,1-5H3,(H,23,26)(H,24,25).
What are the key properties of tert-butyl N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)-2-phenylethyl]carbamate?
tert-butyl N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)-2-phenylethyl]carbamate has a molecular weight of 365.48 g/mol, XLogP of 4.84, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)-2-phenylethyl]carbamate is sourced from PubChem (CID 140840685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).