C22H13F2I6O8S- — CID 140841694
2-[2,4-bis[(2,4,6-triiodophenoxy)carbonyl]cyclohexyl]-1,1-difluoro-2-oxoethanesulfonate (PubChem CID 140841694) has the molecular formula C22H13F2I6O8S- and a molecular weight of 1236.83 g/mol. Its IUPAC name is 2-[2,4-bis[(2,4,6-triiodophenoxy)carbonyl]cyclohexyl]-1,1-difluoro-2-oxoethanesulfonate.
| Compound Name | 2-[2,4-bis[(2,4,6-triiodophenoxy)carbonyl]cyclohexyl]-1,1-difluoro-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 140841694 |
| Molecular Formula | C22H13F2I6O8S- |
| Molecular Weight | 1236.83 g/mol |
| Exact Mass | 1236.46 |
| IUPAC Name | 2-[2,4-bis[(2,4,6-triiodophenoxy)carbonyl]cyclohexyl]-1,1-difluoro-2-oxoethanesulfonate |
| SMILES | O=C(Oc1c(I)cc(I)cc1I)C1CCC(C(=O)C(F)(F)S(=O)(=O)[O-])C(C(=O)Oc2c(I)cc(I)cc2I)C1 |
| InChI | InChI=1S/C22H14F2I6O8S/c23-22(24,39(34,35)36)19(31)11-2-1-8(20(32)37-17-13(27)4-9(25)5-14(17)28)3-12(11)21(33)38-18-15(29)6-10(26)7-16(18)30/h4-8,11-12H,1-3H2,(H,34,35,36)/p-1 |
| InChIKey | ZPKUVISVXOZEAO-UHFFFAOYSA-M |
| XLogP | 6.56 |
| TPSA | 126.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1236.83 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|