C46H29N3 — CID 140843684
2,4-bis(2,3,4,5,6-pentadeuteriophenyl)-6-spiro[benzo[c]fluorene-7,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaene]-5'-yl-1,3,5-triazine (PubChem CID 140843684) has the molecular formula C46H29N3 and a molecular weight of 633.82 g/mol. Its IUPAC name is 2,4-bis(2,3,4,5,6-pentadeuteriophenyl)-6-spiro[benzo[c]fluorene-7,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaene]-5'-yl-1,3,5-triazine.
| Compound Name | 2,4-bis(2,3,4,5,6-pentadeuteriophenyl)-6-spiro[benzo[c]fluorene-7,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaene]-5'-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 140843684 |
| Molecular Formula | C46H29N3 |
| Molecular Weight | 633.82 g/mol |
| Exact Mass | 633.30 |
| IUPAC Name | 2,4-bis(2,3,4,5,6-pentadeuteriophenyl)-6-spiro[benzo[c]fluorene-7,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaene]-5'-yl-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc4c(c3)C3(c5ccccc5C=C4)c4ccccc4-c4c3ccc3ccccc43)nc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])n2)c([2H])c1[2H] |
| InChI | InChI=1S/C46H29N3/c1-3-15-33(16-4-1)43-47-44(34-17-5-2-6-18-34)49-45(48-43)35-26-25-32-24-23-31-14-8-11-21-38(31)46(41(32)29-35)39-22-12-10-20-37(39)42-36-19-9-7-13-30(36)27-28-40(42)46/h1-29H/i1D,2D,3D,4D,5D,6D,15D,16D,17D,18D |
| InChIKey | GXTPHMPLILFBTC-IAYLIHTGSA-N |
| XLogP | 10.87 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.82 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|