C62H51N3Si2 — CID 177087826
trimethyl-[4-[4-[4-(4-spiro[benzo[g]fluorene-7,9'-fluorene]-9-ylphenyl)phenyl]-6-(4-trimethylsilylphenyl)-1,3,5-triazin-2-yl]phenyl]silane (PubChem CID 177087826) has the molecular formula C62H51N3Si2 and a molecular weight of 894.28 g/mol. Its IUPAC name is trimethyl-[4-[4-[4-(4-spiro[benzo[g]fluorene-7,9'-fluorene]-9-ylphenyl)phenyl]-6-(4-trimethylsilylphenyl)-1,3,5-triazin-2-yl]phenyl]silane.
| Compound Name | trimethyl-[4-[4-[4-(4-spiro[benzo[g]fluorene-7,9'-fluorene]-9-ylphenyl)phenyl]-6-(4-trimethylsilylphenyl)-1,3,5-triazin-2-yl]phenyl]silane |
|---|---|
| PubChem CID | 177087826 |
| Molecular Formula | C62H51N3Si2 |
| Molecular Weight | 894.28 g/mol |
| Exact Mass | 893.36 |
| IUPAC Name | trimethyl-[4-[4-[4-(4-spiro[benzo[g]fluorene-7,9'-fluorene]-9-ylphenyl)phenyl]-6-(4-trimethylsilylphenyl)-1,3,5-triazin-2-yl]phenyl]silane |
| SMILES | C[Si](C)(C)c1ccc(-c2nc(-c3ccc(-c4ccc(-c5ccc6c(c5)C5(c7ccccc7-c7ccccc75)c5ccc7ccccc7c5-6)cc4)cc3)nc(-c3ccc([Si](C)(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C62H51N3Si2/c1-66(2,3)48-33-27-45(28-34-48)60-63-59(64-61(65-60)46-29-35-49(36-30-46)67(4,5)6)44-25-23-41(24-26-44)40-19-21-42(22-20-40)47-31-37-53-57(39-47)62(56-38-32-43-13-7-8-14-50(43)58(53)56)54-17-11-9-15-51(54)52-16-10-12-18-55(52)62/h7-39H,1-6H3 |
| InChIKey | BQHWJFSZTXWFCS-UHFFFAOYSA-N |
| XLogP | 14.79 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.28 |
| LogP ≤ 5 | 14.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|