C12H24MnN4 — CID 140844861
N,N'-dimethylethane-1,2-diimine;N,N'-dipropylethane-1,2-diimine;manganese (PubChem CID 140844861) has the molecular formula C12H24MnN4 and a molecular weight of 279.29 g/mol. Its IUPAC name is N,N'-dimethylethane-1,2-diimine;N,N'-dipropylethane-1,2-diimine;manganese.
| Compound Name | N,N'-dimethylethane-1,2-diimine;N,N'-dipropylethane-1,2-diimine;manganese |
|---|---|
| PubChem CID | 140844861 |
| Molecular Formula | C12H24MnN4 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | N,N'-dimethylethane-1,2-diimine;N,N'-dipropylethane-1,2-diimine;manganese |
| SMILES | C/N=C/C=N/C.CCC/N=C/C=N/CCC.[Mn] |
| InChI | InChI=1S/C8H16N2.C4H8N2.Mn/c1-3-5-9-7-8-10-6-4-2;1-5-3-4-6-2;/h7-8H,3-6H2,1-2H3;3-4H,1-2H3;/b9-7+,10-8+;5-3+,6-4+; |
| InChIKey | GTOXWNRWQRDCNV-GWRSJUFDSA-N |
| XLogP | 2.33 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|