C24H30N2O3Si — CID 140846831
5-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-(2-methyl-3-phenylphenyl)-1,3-oxazole-2-carboxamide (PubChem CID 140846831) has the molecular formula C24H30N2O3Si and a molecular weight of 422.60 g/mol. Its IUPAC name is 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-(2-methyl-3-phenylphenyl)-1,3-oxazole-2-carboxamide.
| Compound Name | 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-(2-methyl-3-phenylphenyl)-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 140846831 |
| Molecular Formula | C24H30N2O3Si |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-(2-methyl-3-phenylphenyl)-1,3-oxazole-2-carboxamide |
| SMILES | Cc1c(NC(=O)c2ncc(CO[Si](C)(C)C(C)(C)C)o2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C24H30N2O3Si/c1-17-20(18-11-8-7-9-12-18)13-10-14-21(17)26-22(27)23-25-15-19(29-23)16-28-30(5,6)24(2,3)4/h7-15H,16H2,1-6H3,(H,26,27) |
| InChIKey | WZCSEZCUCNXNMW-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|