C25H29Cl2N3O2Si — CID 171489763
5-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[3-(2,3-dichloro-4-pyridinyl)-2-methylphenyl]pyridine-2-carboxamide (PubChem CID 171489763) has the molecular formula C25H29Cl2N3O2Si and a molecular weight of 502.52 g/mol. Its IUPAC name is 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[3-(2,3-dichloro-4-pyridinyl)-2-methylphenyl]pyridine-2-carboxamide.
| Compound Name | 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[3-(2,3-dichloro-4-pyridinyl)-2-methylphenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171489763 |
| Molecular Formula | C25H29Cl2N3O2Si |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[3-(2,3-dichloro-4-pyridinyl)-2-methylphenyl]pyridine-2-carboxamide |
| SMILES | Cc1c(NC(=O)c2ccc(CO[Si](C)(C)C(C)(C)C)cn2)cccc1-c1ccnc(Cl)c1Cl |
| InChI | InChI=1S/C25H29Cl2N3O2Si/c1-16-18(19-12-13-28-23(27)22(19)26)8-7-9-20(16)30-24(31)21-11-10-17(14-29-21)15-32-33(5,6)25(2,3)4/h7-14H,15H2,1-6H3,(H,30,31) |
| InChIKey | LCLVIMGTDFCDGX-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|