C18H12Cl3N3O — CID 175513117
N-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-5-methylpyridine-2-carboxamide (PubChem CID 175513117) has the molecular formula C18H12Cl3N3O and a molecular weight of 392.67 g/mol. Its IUPAC name is N-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-5-methylpyridine-2-carboxamide.
| Compound Name | N-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-5-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 175513117 |
| Molecular Formula | C18H12Cl3N3O |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | N-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-5-methylpyridine-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(-c3ccnc(Cl)c3Cl)c2Cl)nc1 |
| InChI | InChI=1S/C18H12Cl3N3O/c1-10-5-6-14(23-9-10)18(25)24-13-4-2-3-11(15(13)19)12-7-8-22-17(21)16(12)20/h2-9H,1H3,(H,24,25) |
| InChIKey | ZYWPGWFZECOBMY-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|