C26H19Cl2N3O3 — CID 175513110
N-[2-chloro-3-[3-chloro-2-(4-formyl-3-methoxyphenyl)-4-pyridinyl]phenyl]-5-methylpyridine-2-carboxamide (PubChem CID 175513110) has the molecular formula C26H19Cl2N3O3 and a molecular weight of 492.36 g/mol. Its IUPAC name is N-[2-chloro-3-[3-chloro-2-(4-formyl-3-methoxyphenyl)-4-pyridinyl]phenyl]-5-methylpyridine-2-carboxamide.
| Compound Name | N-[2-chloro-3-[3-chloro-2-(4-formyl-3-methoxyphenyl)-4-pyridinyl]phenyl]-5-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 175513110 |
| Molecular Formula | C26H19Cl2N3O3 |
| Molecular Weight | 492.36 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | N-[2-chloro-3-[3-chloro-2-(4-formyl-3-methoxyphenyl)-4-pyridinyl]phenyl]-5-methylpyridine-2-carboxamide |
| SMILES | COc1cc(-c2nccc(-c3cccc(NC(=O)c4ccc(C)cn4)c3Cl)c2Cl)ccc1C=O |
| InChI | InChI=1S/C26H19Cl2N3O3/c1-15-6-9-21(30-13-15)26(33)31-20-5-3-4-18(23(20)27)19-10-11-29-25(24(19)28)16-7-8-17(14-32)22(12-16)34-2/h3-14H,1-2H3,(H,31,33) |
| InChIKey | KPFBMAHIGRGCNN-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.36 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|