C26H17Cl2N3O4 — CID 170696891
N-[2-chloro-3-[3-chloro-2-(4-formyl-3-methoxyphenyl)-4-pyridinyl]phenyl]-5-formylpyridine-2-carboxamide (PubChem CID 170696891) has the molecular formula C26H17Cl2N3O4 and a molecular weight of 506.35 g/mol. Its IUPAC name is N-[2-chloro-3-[3-chloro-2-(4-formyl-3-methoxyphenyl)-4-pyridinyl]phenyl]-5-formylpyridine-2-carboxamide.
| Compound Name | N-[2-chloro-3-[3-chloro-2-(4-formyl-3-methoxyphenyl)-4-pyridinyl]phenyl]-5-formylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 170696891 |
| Molecular Formula | C26H17Cl2N3O4 |
| Molecular Weight | 506.35 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | N-[2-chloro-3-[3-chloro-2-(4-formyl-3-methoxyphenyl)-4-pyridinyl]phenyl]-5-formylpyridine-2-carboxamide |
| SMILES | COc1cc(-c2nccc(-c3cccc(NC(=O)c4ccc(C=O)cn4)c3Cl)c2Cl)ccc1C=O |
| InChI | InChI=1S/C26H17Cl2N3O4/c1-35-22-11-16(6-7-17(22)14-33)25-24(28)19(9-10-29-25)18-3-2-4-20(23(18)27)31-26(34)21-8-5-15(13-32)12-30-21/h2-14H,1H3,(H,31,34) |
| InChIKey | ZHIJFBOMDXFTET-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.35 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|