C18H10Cl3N3O2 — CID 170697178
N-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-5-formylpyridine-2-carboxamide (PubChem CID 170697178) has the molecular formula C18H10Cl3N3O2 and a molecular weight of 406.66 g/mol. Its IUPAC name is N-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-5-formylpyridine-2-carboxamide.
| Compound Name | N-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-5-formylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 170697178 |
| Molecular Formula | C18H10Cl3N3O2 |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | N-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-5-formylpyridine-2-carboxamide |
| SMILES | O=Cc1ccc(C(=O)Nc2cccc(-c3ccnc(Cl)c3Cl)c2Cl)nc1 |
| InChI | InChI=1S/C18H10Cl3N3O2/c19-15-11(12-6-7-22-17(21)16(12)20)2-1-3-13(15)24-18(26)14-5-4-10(9-25)8-23-14/h1-9H,(H,24,26) |
| InChIKey | CAGHDMOAKGROMS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|