C18H17NO2 — CID 140847857
9-tert-butylcarbazole-3,6-dicarbaldehyde (PubChem CID 140847857) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 9-tert-butylcarbazole-3,6-dicarbaldehyde.
| Compound Name | 9-tert-butylcarbazole-3,6-dicarbaldehyde |
|---|---|
| PubChem CID | 140847857 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 9-tert-butylcarbazole-3,6-dicarbaldehyde |
| SMILES | CC(C)(C)n1c2ccc(C=O)cc2c2cc(C=O)ccc21 |
| InChI | InChI=1S/C18H17NO2/c1-18(2,3)19-16-6-4-12(10-20)8-14(16)15-9-13(11-21)5-7-17(15)19/h4-11H,1-3H3 |
| InChIKey | MHUWINJBDQJIBO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|