C24H31NO3 — CID 162523489
methane;9-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbazole-3,6-dicarbaldehyde (PubChem CID 162523489) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is methane;9-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbazole-3,6-dicarbaldehyde.
| Compound Name | methane;9-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbazole-3,6-dicarbaldehyde |
|---|---|
| PubChem CID | 162523489 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | methane;9-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbazole-3,6-dicarbaldehyde |
| SMILES | C.CC(C)(C)OCCC(C)(C)n1c2ccc(C=O)cc2c2cc(C=O)ccc21 |
| InChI | InChI=1S/C23H27NO3.CH4/c1-22(2,3)27-11-10-23(4,5)24-20-8-6-16(14-25)12-18(20)19-13-17(15-26)7-9-21(19)24;/h6-9,12-15H,10-11H2,1-5H3;1H4 |
| InChIKey | VYBWVZPZMRLLSC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|