C25H42O4 — CID 171622091
3-(2,2-dimethylpropanoyl)benzaldehyde;3-methyl-1,3-bis[(2-methylpropan-2-yl)oxy]butane (PubChem CID 171622091) has the molecular formula C25H42O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is 3-(2,2-dimethylpropanoyl)benzaldehyde;3-methyl-1,3-bis[(2-methylpropan-2-yl)oxy]butane.
| Compound Name | 3-(2,2-dimethylpropanoyl)benzaldehyde;3-methyl-1,3-bis[(2-methylpropan-2-yl)oxy]butane |
|---|---|
| PubChem CID | 171622091 |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | 3-(2,2-dimethylpropanoyl)benzaldehyde;3-methyl-1,3-bis[(2-methylpropan-2-yl)oxy]butane |
| SMILES | CC(C)(C)C(=O)c1cccc(C=O)c1.CC(C)(C)OCCC(C)(C)OC(C)(C)C |
| InChI | InChI=1S/C13H28O2.C12H14O2/c1-11(2,3)14-10-9-13(7,8)15-12(4,5)6;1-12(2,3)11(14)10-6-4-5-9(7-10)8-13/h9-10H2,1-8H3;4-8H,1-3H3 |
| InChIKey | RXQPCJKCOSMFLM-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|