C60H72N3Sb — CID 140848919
5,11,17-tritert-butyl-8,14,22-tris(4-tert-butylphenyl)-8,14,22-triaza-1-stibahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene (PubChem CID 140848919) has the molecular formula C60H72N3Sb and a molecular weight of 957.02 g/mol. Its IUPAC name is 5,11,17-tritert-butyl-8,14,22-tris(4-tert-butylphenyl)-8,14,22-triaza-1-stibahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 5,11,17-tritert-butyl-8,14,22-tris(4-tert-butylphenyl)-8,14,22-triaza-1-stibahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 140848919 |
| Molecular Formula | C60H72N3Sb |
| Molecular Weight | 957.02 g/mol |
| Exact Mass | 955.48 |
| IUPAC Name | 5,11,17-tritert-butyl-8,14,22-tris(4-tert-butylphenyl)-8,14,22-triaza-1-stibahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
| SMILES | CC(C)(C)c1ccc(N2c3cc(C(C)(C)C)cc4c3[Sb]3c5c2cc(C(C)(C)C)cc5N(c2ccc(C(C)(C)C)cc2)c2cc(C(C)(C)C)cc(c23)N4c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C60H72N3.Sb/c1-55(2,3)40-19-25-46(26-20-40)61-49-31-43(58(10,11)12)33-51(37-49)62(47-27-21-41(22-28-47)56(4,5)6)53-35-45(60(16,17)18)36-54(39-53)63(48-29-23-42(24-30-48)57(7,8)9)52-34-44(59(13,14)15)32-50(61)38-52;/h19-36H,1-18H3; |
| InChIKey | ZNAYQENIABYMBU-UHFFFAOYSA-N |
| XLogP | 15.34 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.02 |
| LogP ≤ 5 | 15.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|