C50H59N2OSb — CID 140849353
5,11,17-tritert-butyl-14,22-bis(4-tert-butylphenyl)-8-oxa-14,22-diaza-1-stibahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene (PubChem CID 140849353) has the molecular formula C50H59N2OSb and a molecular weight of 825.79 g/mol. Its IUPAC name is 5,11,17-tritert-butyl-14,22-bis(4-tert-butylphenyl)-8-oxa-14,22-diaza-1-stibahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 5,11,17-tritert-butyl-14,22-bis(4-tert-butylphenyl)-8-oxa-14,22-diaza-1-stibahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 140849353 |
| Molecular Formula | C50H59N2OSb |
| Molecular Weight | 825.79 g/mol |
| Exact Mass | 824.37 |
| IUPAC Name | 5,11,17-tritert-butyl-14,22-bis(4-tert-butylphenyl)-8-oxa-14,22-diaza-1-stibahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
| SMILES | CC(C)(C)c1ccc(N2c3cc(C(C)(C)C)cc4c3[Sb]3c5c(cc(C(C)(C)C)cc5N(c5ccc(C(C)(C)C)cc5)c5cc(C(C)(C)C)cc2c53)O4)cc1 |
| InChI | InChI=1S/C50H59N2O.Sb/c1-46(2,3)33-16-20-38(21-17-33)51-40-24-35(48(7,8)9)25-41(30-40)52(39-22-18-34(19-23-39)47(4,5)6)43-27-37(50(13,14)15)29-45(32-43)53-44-28-36(49(10,11)12)26-42(51)31-44;/h16-29H,1-15H3; |
| InChIKey | DCVSLGYKKBWXLD-UHFFFAOYSA-N |
| XLogP | 12.36 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.79 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|