C56H56N4O2 — CID 118912155
3,7-ditert-butyl-10-[6-(3,7-ditert-butylphenoxazin-10-yl)phenanthro[9,10-b]pyrazin-11-yl]phenoxazine (PubChem CID 118912155) has the molecular formula C56H56N4O2 and a molecular weight of 817.09 g/mol. Its IUPAC name is 3,7-ditert-butyl-10-[6-(3,7-ditert-butylphenoxazin-10-yl)phenanthro[9,10-b]pyrazin-11-yl]phenoxazine.
| Compound Name | 3,7-ditert-butyl-10-[6-(3,7-ditert-butylphenoxazin-10-yl)phenanthro[9,10-b]pyrazin-11-yl]phenoxazine |
|---|---|
| PubChem CID | 118912155 |
| Molecular Formula | C56H56N4O2 |
| Molecular Weight | 817.09 g/mol |
| Exact Mass | 816.44 |
| IUPAC Name | 3,7-ditert-butyl-10-[6-(3,7-ditert-butylphenoxazin-10-yl)phenanthro[9,10-b]pyrazin-11-yl]phenoxazine |
| SMILES | CC(C)(C)c1ccc2c(c1)Oc1cc(C(C)(C)C)ccc1N2c1ccc2c3ccc(N4c5ccc(C(C)(C)C)cc5Oc5cc(C(C)(C)C)ccc54)cc3c3nccnc3c2c1 |
| InChI | InChI=1S/C56H56N4O2/c1-53(2,3)33-13-21-43-47(27-33)61-48-28-34(54(4,5)6)14-22-44(48)59(43)37-17-19-39-40-20-18-38(32-42(40)52-51(41(39)31-37)57-25-26-58-52)60-45-23-15-35(55(7,8)9)29-49(45)62-50-30-36(56(10,11)12)16-24-46(50)60/h13-32H,1-12H3 |
| InChIKey | NWKHHNGUZYYSGX-UHFFFAOYSA-N |
| XLogP | 16.28 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.09 |
| LogP ≤ 5 | 16.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|