C84H97NO — CID 145332600
10-[3,5-bis[3,5-bis(4-tert-butylphenyl)phenyl]phenyl]-3,7-bis(2-methylhexan-2-yl)phenoxazine (PubChem CID 145332600) has the molecular formula C84H97NO and a molecular weight of 1136.71 g/mol. Its IUPAC name is 10-[3,5-bis[3,5-bis(4-tert-butylphenyl)phenyl]phenyl]-3,7-bis(2-methylhexan-2-yl)phenoxazine.
| Compound Name | 10-[3,5-bis[3,5-bis(4-tert-butylphenyl)phenyl]phenyl]-3,7-bis(2-methylhexan-2-yl)phenoxazine |
|---|---|
| PubChem CID | 145332600 |
| Molecular Formula | C84H97NO |
| Molecular Weight | 1136.71 g/mol |
| Exact Mass | 1135.76 |
| IUPAC Name | 10-[3,5-bis[3,5-bis(4-tert-butylphenyl)phenyl]phenyl]-3,7-bis(2-methylhexan-2-yl)phenoxazine |
| SMILES | CCCCC(C)(C)c1ccc2c(c1)Oc1cc(C(C)(C)CCCC)ccc1N2c1cc(-c2cc(-c3ccc(C(C)(C)C)cc3)cc(-c3ccc(C(C)(C)C)cc3)c2)cc(-c2cc(-c3ccc(C(C)(C)C)cc3)cc(-c3ccc(C(C)(C)C)cc3)c2)c1 |
| InChI | InChI=1S/C84H97NO/c1-19-21-43-83(15,16)72-39-41-75-77(54-72)86-78-55-73(84(17,18)44-22-20-2)40-42-76(78)85(75)74-52-66(64-47-60(56-23-31-68(32-24-56)79(3,4)5)45-61(48-64)57-25-33-69(34-26-57)80(6,7)8)51-67(53-74)65-49-62(58-27-35-70(36-28-58)81(9,10)11)46-63(50-65)59-29-37-71(38-30-59)82(12,13)14/h23-42,45-55H,19-22,43-44H2,1-18H3 |
| InChIKey | NXENYWCVXZRZFA-UHFFFAOYSA-N |
| XLogP | 25.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1136.71 |
| LogP ≤ 5 | 25.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |