C45H36N2O5 — CID 140824160
9-[2,7-ditert-butyl-9-(6-oxoisochromeno[4,3-b]pyridin-9-yl)xanthen-9-yl]isochromeno[4,3-b]pyridin-6-one (PubChem CID 140824160) has the molecular formula C45H36N2O5 and a molecular weight of 684.79 g/mol. Its IUPAC name is 9-[2,7-ditert-butyl-9-(6-oxoisochromeno[4,3-b]pyridin-9-yl)xanthen-9-yl]isochromeno[4,3-b]pyridin-6-one.
| Compound Name | 9-[2,7-ditert-butyl-9-(6-oxoisochromeno[4,3-b]pyridin-9-yl)xanthen-9-yl]isochromeno[4,3-b]pyridin-6-one |
|---|---|
| PubChem CID | 140824160 |
| Molecular Formula | C45H36N2O5 |
| Molecular Weight | 684.79 g/mol |
| Exact Mass | 684.26 |
| IUPAC Name | 9-[2,7-ditert-butyl-9-(6-oxoisochromeno[4,3-b]pyridin-9-yl)xanthen-9-yl]isochromeno[4,3-b]pyridin-6-one |
| SMILES | CC(C)(C)c1ccc2c(c1)C(c1ccc3c(=O)oc4cccnc4c3c1)(c1ccc3c(=O)oc4cccnc4c3c1)c1cc(C(C)(C)C)ccc1O2 |
| InChI | InChI=1S/C45H36N2O5/c1-43(2,3)25-13-17-35-33(23-25)45(34-24-26(44(4,5)6)14-18-36(34)50-35,27-11-15-29-31(21-27)39-37(51-41(29)48)9-7-19-46-39)28-12-16-30-32(22-28)40-38(52-42(30)49)10-8-20-47-40/h7-24H,1-6H3 |
| InChIKey | MRCAEANICMOYPI-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 95.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.79 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|