C52H32N4O — CID 140850505
9-[4-[4-(3-dibenzofuran-4-yl-6-isocyanocarbazol-9-yl)-2-methylphenyl]-3-methylphenyl]carbazole-3-carbonitrile (PubChem CID 140850505) has the molecular formula C52H32N4O and a molecular weight of 728.86 g/mol. Its IUPAC name is 9-[4-[4-(3-dibenzofuran-4-yl-6-isocyanocarbazol-9-yl)-2-methylphenyl]-3-methylphenyl]carbazole-3-carbonitrile.
| Compound Name | 9-[4-[4-(3-dibenzofuran-4-yl-6-isocyanocarbazol-9-yl)-2-methylphenyl]-3-methylphenyl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 140850505 |
| Molecular Formula | C52H32N4O |
| Molecular Weight | 728.86 g/mol |
| Exact Mass | 728.26 |
| IUPAC Name | 9-[4-[4-(3-dibenzofuran-4-yl-6-isocyanocarbazol-9-yl)-2-methylphenyl]-3-methylphenyl]carbazole-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(-c3cccc4c3oc3ccccc34)ccc1n2-c1ccc(-c2ccc(-n3c4ccccc4c4cc(C#N)ccc43)cc2C)c(C)c1 |
| InChI | InChI=1S/C52H32N4O/c1-31-25-36(55-47-13-6-4-9-41(47)44-27-33(30-53)15-22-48(44)55)18-20-38(31)39-21-19-37(26-32(39)2)56-49-23-16-34(28-45(49)46-29-35(54-3)17-24-50(46)56)40-11-8-12-43-42-10-5-7-14-51(42)57-52(40)43/h4-29H,1-2H3 |
| InChIKey | AHYHIWWVGJYIDX-UHFFFAOYSA-N |
| XLogP | 14.15 |
| TPSA | 51.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.86 |
| LogP ≤ 5 | 14.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|