C43H60Si — CID 140852666
(2,5-dimethylcyclopenta-2,4-dien-1-yl)-tris[3,5-di(propan-2-yl)phenyl]silane (PubChem CID 140852666) has the molecular formula C43H60Si and a molecular weight of 605.04 g/mol. Its IUPAC name is (2,5-dimethylcyclopenta-2,4-dien-1-yl)-tris[3,5-di(propan-2-yl)phenyl]silane.
| Compound Name | (2,5-dimethylcyclopenta-2,4-dien-1-yl)-tris[3,5-di(propan-2-yl)phenyl]silane |
|---|---|
| PubChem CID | 140852666 |
| Molecular Formula | C43H60Si |
| Molecular Weight | 605.04 g/mol |
| Exact Mass | 604.45 |
| IUPAC Name | (2,5-dimethylcyclopenta-2,4-dien-1-yl)-tris[3,5-di(propan-2-yl)phenyl]silane |
| SMILES | CC1=CC=C(C)C1[Si](c1cc(C(C)C)cc(C(C)C)c1)(c1cc(C(C)C)cc(C(C)C)c1)c1cc(C(C)C)cc(C(C)C)c1 |
| InChI | InChI=1S/C43H60Si/c1-26(2)34-17-35(27(3)4)21-40(20-34)44(43-32(13)15-16-33(43)14,41-22-36(28(5)6)18-37(23-41)29(7)8)42-24-38(30(9)10)19-39(25-42)31(11)12/h15-31,43H,1-14H3 |
| InChIKey | VAAQHDWKOPLFLD-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.04 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|