C24H17FN6O5 — CID 140852833
[5-[[5-fluoro-2-(3-methoxy-4-pyridin-4-ylanilino)pyrimidin-4-yl]amino]-2-oxo-1,3-benzoxazol-3-yl] formate (PubChem CID 140852833) has the molecular formula C24H17FN6O5 and a molecular weight of 488.44 g/mol. Its IUPAC name is [5-[[5-fluoro-2-(3-methoxy-4-pyridin-4-ylanilino)pyrimidin-4-yl]amino]-2-oxo-1,3-benzoxazol-3-yl] formate.
| Compound Name | [5-[[5-fluoro-2-(3-methoxy-4-pyridin-4-ylanilino)pyrimidin-4-yl]amino]-2-oxo-1,3-benzoxazol-3-yl] formate |
|---|---|
| PubChem CID | 140852833 |
| Molecular Formula | C24H17FN6O5 |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | [5-[[5-fluoro-2-(3-methoxy-4-pyridin-4-ylanilino)pyrimidin-4-yl]amino]-2-oxo-1,3-benzoxazol-3-yl] formate |
| SMILES | COc1cc(Nc2ncc(F)c(Nc3ccc4oc(=O)n(OC=O)c4c3)n2)ccc1-c1ccncc1 |
| InChI | InChI=1S/C24H17FN6O5/c1-34-21-11-16(2-4-17(21)14-6-8-26-9-7-14)29-23-27-12-18(25)22(30-23)28-15-3-5-20-19(10-15)31(35-13-32)24(33)36-20/h2-13H,1H3,(H2,27,28,29,30) |
| InChIKey | JFONFGWMHKTBEZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|