C19H16Cl2FN5O3 — CID 174489111
[4-[[4-(3,5-dichloro-4-methoxyanilino)-5-fluoropyrimidin-2-yl]amino]-2-(methylamino)phenyl] formate (PubChem CID 174489111) has the molecular formula C19H16Cl2FN5O3 and a molecular weight of 452.27 g/mol. Its IUPAC name is [4-[[4-(3,5-dichloro-4-methoxyanilino)-5-fluoropyrimidin-2-yl]amino]-2-(methylamino)phenyl] formate.
| Compound Name | [4-[[4-(3,5-dichloro-4-methoxyanilino)-5-fluoropyrimidin-2-yl]amino]-2-(methylamino)phenyl] formate |
|---|---|
| PubChem CID | 174489111 |
| Molecular Formula | C19H16Cl2FN5O3 |
| Molecular Weight | 452.27 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | [4-[[4-(3,5-dichloro-4-methoxyanilino)-5-fluoropyrimidin-2-yl]amino]-2-(methylamino)phenyl] formate |
| SMILES | CNc1cc(Nc2ncc(F)c(Nc3cc(Cl)c(OC)c(Cl)c3)n2)ccc1OC=O |
| InChI | InChI=1S/C19H16Cl2FN5O3/c1-23-15-7-10(3-4-16(15)30-9-28)26-19-24-8-14(22)18(27-19)25-11-5-12(20)17(29-2)13(21)6-11/h3-9,23H,1-2H3,(H2,24,25,26,27) |
| InChIKey | KEOGDDXPLSAJCU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.27 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|