C27H35N2O3+ — CID 140856631
[(E)-1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino] pyridin-1-ium-3-carboxylate (PubChem CID 140856631) has the molecular formula C27H35N2O3+ and a molecular weight of 435.59 g/mol. Its IUPAC name is [(E)-1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino] pyridin-1-ium-3-carboxylate.
| Compound Name | [(E)-1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino] pyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 140856631 |
| Molecular Formula | C27H35N2O3+ |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | [(E)-1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino] pyridin-1-ium-3-carboxylate |
| SMILES | C/C(=N\OC(=O)c1ccc[nH+]c1)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H34N2O3/c1-17(29-32-25(31)18-5-4-14-28-16-18)22-8-9-23-21-7-6-19-15-20(30)10-12-26(19,2)24(21)11-13-27(22,23)3/h4-5,14-16,21-24H,6-13H2,1-3H3/p+1/b29-17+/t21-,22+,23-,24-,26-,27+/m0/s1 |
| InChIKey | GQTSZKZTDSCNIA-CZFHXOOJSA-O |
| XLogP | 5.18 |
| TPSA | 69.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|