C33H46ClN3O5 — CID 140858690
(2R,3R,4R,5R)-3-tert-butyl-4-[(4-chloro-2-methoxyphenyl)methylamino]-5-[2-(dimethylamino)phenyl]-1-(2,2-dimethyloxane-4-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 140858690) has the molecular formula C33H46ClN3O5 and a molecular weight of 600.20 g/mol. Its IUPAC name is (2R,3R,4R,5R)-3-tert-butyl-4-[(4-chloro-2-methoxyphenyl)methylamino]-5-[2-(dimethylamino)phenyl]-1-(2,2-dimethyloxane-4-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,3R,4R,5R)-3-tert-butyl-4-[(4-chloro-2-methoxyphenyl)methylamino]-5-[2-(dimethylamino)phenyl]-1-(2,2-dimethyloxane-4-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 140858690 |
| Molecular Formula | C33H46ClN3O5 |
| Molecular Weight | 600.20 g/mol |
| Exact Mass | 599.31 |
| IUPAC Name | (2R,3R,4R,5R)-3-tert-butyl-4-[(4-chloro-2-methoxyphenyl)methylamino]-5-[2-(dimethylamino)phenyl]-1-(2,2-dimethyloxane-4-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | COc1cc(Cl)ccc1CN[C@@H]1[C@@H](C(C)(C)C)[C@H](C(=O)O)N(C(=O)C2CCOC(C)(C)C2)[C@@H]1c1ccccc1N(C)C |
| InChI | InChI=1S/C33H46ClN3O5/c1-32(2,3)26-27(35-19-21-13-14-22(34)17-25(21)41-8)28(23-11-9-10-12-24(23)36(6)7)37(29(26)31(39)40)30(38)20-15-16-42-33(4,5)18-20/h9-14,17,20,26-29,35H,15-16,18-19H2,1-8H3,(H,39,40)/t20?,26-,27-,28-,29-/m1/s1 |
| InChIKey | QEKYKKUNLMOBJS-RJVRKBLYSA-N |
| XLogP | 5.78 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.20 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |