C21H23BF4N2O4 — CID 140861595
[(1R)-1-[3-[ethyl-[4-(trifluoromethyl)benzoyl]amino]propanoylamino]-2-(4-fluorophenyl)ethyl]boronic acid (PubChem CID 140861595) has the molecular formula C21H23BF4N2O4 and a molecular weight of 454.23 g/mol. Its IUPAC name is [(1R)-1-[3-[ethyl-[4-(trifluoromethyl)benzoyl]amino]propanoylamino]-2-(4-fluorophenyl)ethyl]boronic acid.
| Compound Name | [(1R)-1-[3-[ethyl-[4-(trifluoromethyl)benzoyl]amino]propanoylamino]-2-(4-fluorophenyl)ethyl]boronic acid |
|---|---|
| PubChem CID | 140861595 |
| Molecular Formula | C21H23BF4N2O4 |
| Molecular Weight | 454.23 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | [(1R)-1-[3-[ethyl-[4-(trifluoromethyl)benzoyl]amino]propanoylamino]-2-(4-fluorophenyl)ethyl]boronic acid |
| SMILES | CCN(CCC(=O)N[C@@H](Cc1ccc(F)cc1)B(O)O)C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H23BF4N2O4/c1-2-28(20(30)15-5-7-16(8-6-15)21(24,25)26)12-11-19(29)27-18(22(31)32)13-14-3-9-17(23)10-4-14/h3-10,18,31-32H,2,11-13H2,1H3,(H,27,29)/t18-/m0/s1 |
| InChIKey | UGFBYUBXVXRSAT-SFHVURJKSA-N |
| XLogP | 2.44 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.23 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|