C21H23BF4N2O5 — CID 142771971
[(1R)-1-[3-[ethyl-[4-(trifluoromethyl)benzoyl]amino]propanoylamino]-2-(4-fluorophenyl)ethoxy]boronic acid (PubChem CID 142771971) has the molecular formula C21H23BF4N2O5 and a molecular weight of 470.23 g/mol. Its IUPAC name is [(1R)-1-[3-[ethyl-[4-(trifluoromethyl)benzoyl]amino]propanoylamino]-2-(4-fluorophenyl)ethoxy]boronic acid.
| Compound Name | [(1R)-1-[3-[ethyl-[4-(trifluoromethyl)benzoyl]amino]propanoylamino]-2-(4-fluorophenyl)ethoxy]boronic acid |
|---|---|
| PubChem CID | 142771971 |
| Molecular Formula | C21H23BF4N2O5 |
| Molecular Weight | 470.23 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | [(1R)-1-[3-[ethyl-[4-(trifluoromethyl)benzoyl]amino]propanoylamino]-2-(4-fluorophenyl)ethoxy]boronic acid |
| SMILES | CCN(CCC(=O)N[C@@H](Cc1ccc(F)cc1)OB(O)O)C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H23BF4N2O5/c1-2-28(20(30)15-5-7-16(8-6-15)21(24,25)26)12-11-18(29)27-19(33-22(31)32)13-14-3-9-17(23)10-4-14/h3-10,19,31-32H,2,11-13H2,1H3,(H,27,29)/t19-/m1/s1 |
| InChIKey | UWYWIFBYMVFFTK-LJQANCHMSA-N |
| XLogP | 2.37 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|