C25H33N3O6 — CID 140861912
ethyl 2-amino-2-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-phenyl-2-pyridinyl]acetate (PubChem CID 140861912) has the molecular formula C25H33N3O6 and a molecular weight of 471.55 g/mol. Its IUPAC name is ethyl 2-amino-2-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-phenyl-2-pyridinyl]acetate.
| Compound Name | ethyl 2-amino-2-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-phenyl-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 140861912 |
| Molecular Formula | C25H33N3O6 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | ethyl 2-amino-2-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-phenyl-2-pyridinyl]acetate |
| SMILES | CCOC(=O)C(N)c1ccc(-c2ccccc2)c(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C25H33N3O6/c1-8-32-21(29)19(26)18-15-14-17(16-12-10-9-11-13-16)20(27-18)28(22(30)33-24(2,3)4)23(31)34-25(5,6)7/h9-15,19H,8,26H2,1-7H3 |
| InChIKey | PXWPCGNZEVJVHL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|