C19H22F3N5O2S — CID 140862856
tert-butyl 4-[[2-isocyano-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 140862856) has the molecular formula C19H22F3N5O2S and a molecular weight of 441.48 g/mol. Its IUPAC name is tert-butyl 4-[[2-isocyano-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-isocyano-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140862856 |
| Molecular Formula | C19H22F3N5O2S |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | tert-butyl 4-[[2-isocyano-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | [C-]#[N+]c1nc(NC2CCN(C(=O)OC(C)(C)C)CC2)c2cc(CC(F)(F)F)sc2n1 |
| InChI | InChI=1S/C19H22F3N5O2S/c1-18(2,3)29-17(28)27-7-5-11(6-8-27)24-14-13-9-12(10-19(20,21)22)30-15(13)26-16(23-4)25-14/h9,11H,5-8,10H2,1-3H3,(H,24,25,26) |
| InChIKey | SITFWCHJXLUMTP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 71.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|