About 5,7-dichloro-3-methyl-2-(phenylmethoxymethyl)pyrazolo[1,5-a]pyrimidine
5,7-dichloro-3-methyl-2-(phenylmethoxymethyl)pyrazolo[1,5-a]pyrimidine (PubChem CID 140863809) has the molecular formula C15H13Cl2N3O
and a molecular weight of 322.19 g/mol. Its IUPAC name is 5,7-dichloro-3-methyl-2-(phenylmethoxymethyl)pyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 5,7-dichloro-3-methyl-2-(phenylmethoxymethyl)pyrazolo[1,5-a]pyrimidine |
| PubChem CID | 140863809 |
| Molecular Formula | C15H13Cl2N3O |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 5,7-dichloro-3-methyl-2-(phenylmethoxymethyl)pyrazolo[1,5-a]pyrimidine |
| SMILES | Cc1c(COCc2ccccc2)nn2c(Cl)cc(Cl)nc12 |
| InChI | InChI=1S/C15H13Cl2N3O/c1-10-12(9-21-8-11-5-3-2-4-6-11)19-20-14(17)7-13(16)18-15(10)20/h2-7H,8-9H2,1H3 |
| InChIKey | NGFGWVGKLNHHOC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,7-dichloro-3-methyl-2-(phenylmethoxymethyl)pyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-3-methyl-2-(phenylmethoxymethyl)pyrazolo[1,5-a]pyrimidine?
The IUPAC name of 5,7-dichloro-3-methyl-2-(phenylmethoxymethyl)pyrazolo[1,5-a]pyrimidine (CID 140863809) is 5,7-dichloro-3-methyl-2-(phenylmethoxymethyl)pyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 5,7-dichloro-3-methyl-2-(phenylmethoxymethyl)pyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 5,7-dichloro-3-methyl-2-(phenylmethoxymethyl)pyrazolo[1,5-a]pyrimidine is Cc1c(COCc2ccccc2)nn2c(Cl)cc(Cl)nc12.
What is the InChIKey of 5,7-dichloro-3-methyl-2-(phenylmethoxymethyl)pyrazolo[1,5-a]pyrimidine?
The InChIKey is NGFGWVGKLNHHOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2N3O/c1-10-12(9-21-8-11-5-3-2-4-6-11)19-20-14(17)7-13(16)18-15(10)20/h2-7H,8-9H2,1H3.
What are the key properties of 5,7-dichloro-3-methyl-2-(phenylmethoxymethyl)pyrazolo[1,5-a]pyrimidine?
5,7-dichloro-3-methyl-2-(phenylmethoxymethyl)pyrazolo[1,5-a]pyrimidine has a molecular weight of 322.19 g/mol, XLogP of 4.06, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-3-methyl-2-(phenylmethoxymethyl)pyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 140863809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).