C33H30N4OSi — CID 140864719
3-[1-methyl-4-[3-phenyl-5-(5-trimethylsilyl-2-pyridinyl)phenyl]benzimidazol-2-yl]-1H-pyridin-2-one (PubChem CID 140864719) has the molecular formula C33H30N4OSi and a molecular weight of 526.72 g/mol. Its IUPAC name is 3-[1-methyl-4-[3-phenyl-5-(5-trimethylsilyl-2-pyridinyl)phenyl]benzimidazol-2-yl]-1H-pyridin-2-one.
| Compound Name | 3-[1-methyl-4-[3-phenyl-5-(5-trimethylsilyl-2-pyridinyl)phenyl]benzimidazol-2-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 140864719 |
| Molecular Formula | C33H30N4OSi |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 3-[1-methyl-4-[3-phenyl-5-(5-trimethylsilyl-2-pyridinyl)phenyl]benzimidazol-2-yl]-1H-pyridin-2-one |
| SMILES | Cn1c(-c2ccc[nH]c2=O)nc2c(-c3cc(-c4ccccc4)cc(-c4ccc([Si](C)(C)C)cn4)c3)cccc21 |
| InChI | InChI=1S/C33H30N4OSi/c1-37-30-14-8-12-27(31(30)36-32(37)28-13-9-17-34-33(28)38)24-18-23(22-10-6-5-7-11-22)19-25(20-24)29-16-15-26(21-35-29)39(2,3)4/h5-21H,1-4H3,(H,34,38) |
| InChIKey | YPLLKBQBLAOHRN-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|